C30H31N2+ — CID 144995571
2-[2-[(1R)-1-[2-(4-methyl-5-phenyl-2H-pyrrol-1-ium-2-yl)phenyl]ethyl]phenyl]-1,2,3,6-tetrahydropyridine (PubChem CID 144995571) has the molecular formula C30H31N2+ and a molecular weight of 419.59 g/mol. Its IUPAC name is 2-[2-[(1R)-1-[2-(4-methyl-5-phenyl-2H-pyrrol-1-ium-2-yl)phenyl]ethyl]phenyl]-1,2,3,6-tetrahydropyridine.
| Compound Name | 2-[2-[(1R)-1-[2-(4-methyl-5-phenyl-2H-pyrrol-1-ium-2-yl)phenyl]ethyl]phenyl]-1,2,3,6-tetrahydropyridine |
|---|---|
| PubChem CID | 144995571 |
| Molecular Formula | C30H31N2+ |
| Molecular Weight | 419.59 g/mol |
| Exact Mass | 419.25 |
| IUPAC Name | 2-[2-[(1R)-1-[2-(4-methyl-5-phenyl-2H-pyrrol-1-ium-2-yl)phenyl]ethyl]phenyl]-1,2,3,6-tetrahydropyridine |
| SMILES | CC1=CC(c2ccccc2[C@H](C)c2ccccc2C2CC=CCN2)[NH+]=C1c1ccccc1 |
| InChI | InChI=1S/C30H30N2/c1-21-20-29(32-30(21)23-12-4-3-5-13-23)27-17-9-7-15-25(27)22(2)24-14-6-8-16-26(24)28-18-10-11-19-31-28/h3-17,20,22,28-29,31H,18-19H2,1-2H3/p+1/t22-,28?,29?/m1/s1 |
| InChIKey | CROPIJFRIZFRDT-JOLTYGGCSA-O |
| XLogP | 5.00 |
| TPSA | 26.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.59 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|