C14H22F2N2O2 — CID 144995647
1-[(3Z,5E)-2,4-difluoro-6-(2-methoxyethoxy)hepta-1,3,5-trien-3-yl]piperazine (PubChem CID 144995647) has the molecular formula C14H22F2N2O2 and a molecular weight of 288.34 g/mol. Its IUPAC name is 1-[(3Z,5E)-2,4-difluoro-6-(2-methoxyethoxy)hepta-1,3,5-trien-3-yl]piperazine.
| Compound Name | 1-[(3Z,5E)-2,4-difluoro-6-(2-methoxyethoxy)hepta-1,3,5-trien-3-yl]piperazine |
|---|---|
| PubChem CID | 144995647 |
| Molecular Formula | C14H22F2N2O2 |
| Molecular Weight | 288.34 g/mol |
| Exact Mass | 288.16 |
| IUPAC Name | 1-[(3Z,5E)-2,4-difluoro-6-(2-methoxyethoxy)hepta-1,3,5-trien-3-yl]piperazine |
| SMILES | C=C(F)/C(=C(F)\C=C(/C)OCCOC)N1CCNCC1 |
| InChI | InChI=1S/C14H22F2N2O2/c1-11(20-9-8-19-3)10-13(16)14(12(2)15)18-6-4-17-5-7-18/h10,17H,2,4-9H2,1,3H3/b11-10+,14-13- |
| InChIKey | JGMKNTDBTKCLPG-SVEAWWMOSA-N |
| XLogP | 2.12 |
| TPSA | 33.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.34 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|