C16H28FNO — CID 144995650
N-[2-[(3E,5E)-6-fluorohepta-1,3,5-trien-4-yl]oxyethyl]-N-methylhexan-1-amine (PubChem CID 144995650) has the molecular formula C16H28FNO and a molecular weight of 269.40 g/mol. Its IUPAC name is N-[2-[(3E,5E)-6-fluorohepta-1,3,5-trien-4-yl]oxyethyl]-N-methylhexan-1-amine.
| Compound Name | N-[2-[(3E,5E)-6-fluorohepta-1,3,5-trien-4-yl]oxyethyl]-N-methylhexan-1-amine |
|---|---|
| PubChem CID | 144995650 |
| Molecular Formula | C16H28FNO |
| Molecular Weight | 269.40 g/mol |
| Exact Mass | 269.22 |
| IUPAC Name | N-[2-[(3E,5E)-6-fluorohepta-1,3,5-trien-4-yl]oxyethyl]-N-methylhexan-1-amine |
| SMILES | C=C/C=C(\C=C(/C)F)OCCN(C)CCCCCC |
| InChI | InChI=1S/C16H28FNO/c1-5-7-8-9-11-18(4)12-13-19-16(10-6-2)14-15(3)17/h6,10,14H,2,5,7-9,11-13H2,1,3-4H3/b15-14+,16-10+ |
| InChIKey | SEOYZNLDVZWOKB-AYCNDHBZSA-N |
| XLogP | 4.46 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.40 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|