C19H24O3 — CID 144996501
(2Z,4E)-5-(2,6-dimethyl-4-oxo-3-pent-2-ynylcyclohex-2-en-1-yl)-3-methylpenta-2,4-dienoic acid (PubChem CID 144996501) has the molecular formula C19H24O3 and a molecular weight of 300.40 g/mol. Its IUPAC name is (2Z,4E)-5-(2,6-dimethyl-4-oxo-3-pent-2-ynylcyclohex-2-en-1-yl)-3-methylpenta-2,4-dienoic acid.
| Compound Name | (2Z,4E)-5-(2,6-dimethyl-4-oxo-3-pent-2-ynylcyclohex-2-en-1-yl)-3-methylpenta-2,4-dienoic acid |
|---|---|
| PubChem CID | 144996501 |
| Molecular Formula | C19H24O3 |
| Molecular Weight | 300.40 g/mol |
| Exact Mass | 300.17 |
| IUPAC Name | (2Z,4E)-5-(2,6-dimethyl-4-oxo-3-pent-2-ynylcyclohex-2-en-1-yl)-3-methylpenta-2,4-dienoic acid |
| SMILES | CCC#CCC1=C(C)C(/C=C/C(C)=C\C(=O)O)C(C)CC1=O |
| InChI | InChI=1S/C19H24O3/c1-5-6-7-8-17-15(4)16(14(3)12-18(17)20)10-9-13(2)11-19(21)22/h9-11,14,16H,5,8,12H2,1-4H3,(H,21,22)/b10-9+,13-11- |
| InChIKey | KSKXPMDQMATLEX-LTCRFSFDSA-N |
| XLogP | 3.92 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.40 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|