C23H21N7O — CID 144996918
4-[5-[5-amino-6-[amino(cyclopropyl)amino]-3-pyridinyl]-8-methoxyimidazo[1,5-a]pyridin-6-yl]benzonitrile (PubChem CID 144996918) has the molecular formula C23H21N7O and a molecular weight of 411.47 g/mol. Its IUPAC name is 4-[5-[5-amino-6-[amino(cyclopropyl)amino]-3-pyridinyl]-8-methoxyimidazo[1,5-a]pyridin-6-yl]benzonitrile.
| Compound Name | 4-[5-[5-amino-6-[amino(cyclopropyl)amino]-3-pyridinyl]-8-methoxyimidazo[1,5-a]pyridin-6-yl]benzonitrile |
|---|---|
| PubChem CID | 144996918 |
| Molecular Formula | C23H21N7O |
| Molecular Weight | 411.47 g/mol |
| Exact Mass | 411.18 |
| IUPAC Name | 4-[5-[5-amino-6-[amino(cyclopropyl)amino]-3-pyridinyl]-8-methoxyimidazo[1,5-a]pyridin-6-yl]benzonitrile |
| SMILES | COc1cc(-c2ccc(C#N)cc2)c(-c2cnc(N(N)C3CC3)c(N)c2)n2cncc12 |
| InChI | InChI=1S/C23H21N7O/c1-31-21-9-18(15-4-2-14(10-24)3-5-15)22(29-13-27-12-20(21)29)16-8-19(25)23(28-11-16)30(26)17-6-7-17/h2-5,8-9,11-13,17H,6-7,25-26H2,1H3 |
| InChIKey | FQDVVQSCBRNRRQ-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 118.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.47 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|