About 4-[(E,4E)-4-ethylidene-5,5-difluoro-2-methylhept-2-enyl]morpholine
4-[(E,4E)-4-ethylidene-5,5-difluoro-2-methylhept-2-enyl]morpholine (PubChem CID 144997257) has the molecular formula C14H23F2NO
and a molecular weight of 259.34 g/mol. Its IUPAC name is 4-[(E,4E)-4-ethylidene-5,5-difluoro-2-methylhept-2-enyl]morpholine.
Molecular Properties
| Compound Name | 4-[(E,4E)-4-ethylidene-5,5-difluoro-2-methylhept-2-enyl]morpholine |
| PubChem CID | 144997257 |
| Molecular Formula | C14H23F2NO |
| Molecular Weight | 259.34 g/mol |
| Exact Mass | 259.17 |
| IUPAC Name | 4-[(E,4E)-4-ethylidene-5,5-difluoro-2-methylhept-2-enyl]morpholine |
| SMILES | C/C=C(\C=C(/C)CN1CCOCC1)C(F)(F)CC |
| InChI | InChI=1S/C14H23F2NO/c1-4-13(14(15,16)5-2)10-12(3)11-17-6-8-18-9-7-17/h4,10H,5-9,11H2,1-3H3/b12-10+,13-4+ |
| InChIKey | ZHJFQVOCLTZRPU-DHLSWZEKSA-N |
| XLogP | 3.26 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 259.34 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 4-[(E,4E)-4-ethylidene-5,5-difluoro-2-methylhept-2-enyl]morpholine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(E,4E)-4-ethylidene-5,5-difluoro-2-methylhept-2-enyl]morpholine?
The IUPAC name of 4-[(E,4E)-4-ethylidene-5,5-difluoro-2-methylhept-2-enyl]morpholine (CID 144997257) is 4-[(E,4E)-4-ethylidene-5,5-difluoro-2-methylhept-2-enyl]morpholine.
What is the SMILES notation for 4-[(E,4E)-4-ethylidene-5,5-difluoro-2-methylhept-2-enyl]morpholine?
The canonical SMILES for 4-[(E,4E)-4-ethylidene-5,5-difluoro-2-methylhept-2-enyl]morpholine is C/C=C(\C=C(/C)CN1CCOCC1)C(F)(F)CC.
What is the InChIKey of 4-[(E,4E)-4-ethylidene-5,5-difluoro-2-methylhept-2-enyl]morpholine?
The InChIKey is ZHJFQVOCLTZRPU-DHLSWZEKSA-N. The full InChI is InChI=1S/C14H23F2NO/c1-4-13(14(15,16)5-2)10-12(3)11-17-6-8-18-9-7-17/h4,10H,5-9,11H2,1-3H3/b12-10+,13-4+.
What are the key properties of 4-[(E,4E)-4-ethylidene-5,5-difluoro-2-methylhept-2-enyl]morpholine?
4-[(E,4E)-4-ethylidene-5,5-difluoro-2-methylhept-2-enyl]morpholine has a molecular weight of 259.34 g/mol, XLogP of 3.26, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(E,4E)-4-ethylidene-5,5-difluoro-2-methylhept-2-enyl]morpholine is sourced from PubChem (CID 144997257), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).