C21H47N3O2 — CID 144997499
ethane;(4-methylcyclohexyl)methanamine;3-methyl-2-(methylamino)-N-(2-oxopropyl)butanamide (PubChem CID 144997499) has the molecular formula C21H47N3O2 and a molecular weight of 373.63 g/mol. Its IUPAC name is ethane;(4-methylcyclohexyl)methanamine;3-methyl-2-(methylamino)-N-(2-oxopropyl)butanamide.
| Compound Name | ethane;(4-methylcyclohexyl)methanamine;3-methyl-2-(methylamino)-N-(2-oxopropyl)butanamide |
|---|---|
| PubChem CID | 144997499 |
| Molecular Formula | C21H47N3O2 |
| Molecular Weight | 373.63 g/mol |
| Exact Mass | 373.37 |
| IUPAC Name | ethane;(4-methylcyclohexyl)methanamine;3-methyl-2-(methylamino)-N-(2-oxopropyl)butanamide |
| SMILES | CC.CC.CC1CCC(CN)CC1.CNC(C(=O)NCC(C)=O)C(C)C |
| InChI | InChI=1S/C9H18N2O2.C8H17N.2C2H6/c1-6(2)8(10-4)9(13)11-5-7(3)12;1-7-2-4-8(6-9)5-3-7;2*1-2/h6,8,10H,5H2,1-4H3,(H,11,13);7-8H,2-6,9H2,1H3;2*1-2H3 |
| InChIKey | YGAKFLIZRXUNMW-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.63 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |