About 6-ethyl-3-methyl-1,6-dihydropyridazine;propane
6-ethyl-3-methyl-1,6-dihydropyridazine;propane (PubChem CID 144998160) has the molecular formula C10H20N2
and a molecular weight of 168.28 g/mol. Its IUPAC name is 6-ethyl-3-methyl-1,6-dihydropyridazine;propane.
Molecular Properties
| Compound Name | 6-ethyl-3-methyl-1,6-dihydropyridazine;propane |
| PubChem CID | 144998160 |
| Molecular Formula | C10H20N2 |
| Molecular Weight | 168.28 g/mol |
| Exact Mass | 168.16 |
| IUPAC Name | 6-ethyl-3-methyl-1,6-dihydropyridazine;propane |
| SMILES | CCC.CCC1C=CC(C)=NN1 |
| InChI | InChI=1S/C7H12N2.C3H8/c1-3-7-5-4-6(2)8-9-7;1-3-2/h4-5,7,9H,3H2,1-2H3;3H2,1-2H3 |
| InChIKey | PIWDXJXKHMFINL-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 168.28 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 6-ethyl-3-methyl-1,6-dihydropyridazine;propane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-ethyl-3-methyl-1,6-dihydropyridazine;propane?
The IUPAC name of 6-ethyl-3-methyl-1,6-dihydropyridazine;propane (CID 144998160) is 6-ethyl-3-methyl-1,6-dihydropyridazine;propane.
What is the SMILES notation for 6-ethyl-3-methyl-1,6-dihydropyridazine;propane?
The canonical SMILES for 6-ethyl-3-methyl-1,6-dihydropyridazine;propane is CCC.CCC1C=CC(C)=NN1.
What is the InChIKey of 6-ethyl-3-methyl-1,6-dihydropyridazine;propane?
The InChIKey is PIWDXJXKHMFINL-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H12N2.C3H8/c1-3-7-5-4-6(2)8-9-7;1-3-2/h4-5,7,9H,3H2,1-2H3;3H2,1-2H3.
What are the key properties of 6-ethyl-3-methyl-1,6-dihydropyridazine;propane?
6-ethyl-3-methyl-1,6-dihydropyridazine;propane has a molecular weight of 168.28 g/mol, XLogP of 2.72, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-ethyl-3-methyl-1,6-dihydropyridazine;propane is sourced from PubChem (CID 144998160), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).