C22H27FN6O — CID 144999653
4-(6,6-dimethyl-1,4,5,7-tetrahydroindazol-3-yl)-6-fluoro-N-[1-(5-methyl-1,2,4-oxadiazol-3-yl)cyclopentyl]pyridin-2-amine (PubChem CID 144999653) has the molecular formula C22H27FN6O and a molecular weight of 410.50 g/mol. Its IUPAC name is 4-(6,6-dimethyl-1,4,5,7-tetrahydroindazol-3-yl)-6-fluoro-N-[1-(5-methyl-1,2,4-oxadiazol-3-yl)cyclopentyl]pyridin-2-amine.
| Compound Name | 4-(6,6-dimethyl-1,4,5,7-tetrahydroindazol-3-yl)-6-fluoro-N-[1-(5-methyl-1,2,4-oxadiazol-3-yl)cyclopentyl]pyridin-2-amine |
|---|---|
| PubChem CID | 144999653 |
| Molecular Formula | C22H27FN6O |
| Molecular Weight | 410.50 g/mol |
| Exact Mass | 410.22 |
| IUPAC Name | 4-(6,6-dimethyl-1,4,5,7-tetrahydroindazol-3-yl)-6-fluoro-N-[1-(5-methyl-1,2,4-oxadiazol-3-yl)cyclopentyl]pyridin-2-amine |
| SMILES | Cc1nc(C2(Nc3cc(-c4n[nH]c5c4CCC(C)(C)C5)cc(F)n3)CCCC2)no1 |
| InChI | InChI=1S/C22H27FN6O/c1-13-24-20(29-30-13)22(7-4-5-8-22)26-18-11-14(10-17(23)25-18)19-15-6-9-21(2,3)12-16(15)27-28-19/h10-11H,4-9,12H2,1-3H3,(H,25,26)(H,27,28) |
| InChIKey | PLGOVGZNMAARJA-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 92.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.50 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|