C24H33N5O — CID 144999654
N-[3-(2-amino-4,4-dimethylcyclohexene-1-carboximidoyl)phenyl]formamide;N-methyl-1-(4-methyl-3-pyridinyl)methanamine (PubChem CID 144999654) has the molecular formula C24H33N5O and a molecular weight of 407.56 g/mol. Its IUPAC name is N-[3-(2-amino-4,4-dimethylcyclohexene-1-carboximidoyl)phenyl]formamide;N-methyl-1-(4-methyl-3-pyridinyl)methanamine.
| Compound Name | N-[3-(2-amino-4,4-dimethylcyclohexene-1-carboximidoyl)phenyl]formamide;N-methyl-1-(4-methyl-3-pyridinyl)methanamine |
|---|---|
| PubChem CID | 144999654 |
| Molecular Formula | C24H33N5O |
| Molecular Weight | 407.56 g/mol |
| Exact Mass | 407.27 |
| IUPAC Name | N-[3-(2-amino-4,4-dimethylcyclohexene-1-carboximidoyl)phenyl]formamide;N-methyl-1-(4-methyl-3-pyridinyl)methanamine |
| SMILES | CNCc1cnccc1C.[H]/N=C(/C1=C(N)CC(C)(C)CC1)c1cccc(NC=O)c1 |
| InChI | InChI=1S/C16H21N3O.C8H12N2/c1-16(2)7-6-13(14(17)9-16)15(18)11-4-3-5-12(8-11)19-10-20;1-7-3-4-10-6-8(7)5-9-2/h3-5,8,10,18H,6-7,9,17H2,1-2H3,(H,19,20);3-4,6,9H,5H2,1-2H3/b18-15+; |
| InChIKey | BQOSXRODENPHLS-FLNCGGNMSA-N |
| XLogP | 4.16 |
| TPSA | 103.89 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.56 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|