C16H20N4 — CID 144999914
5,5-dimethyl-2-(1H-pyrrolo[2,3-b]pyridine-5-carboximidoyl)cyclohexen-1-amine (PubChem CID 144999914) has the molecular formula C16H20N4 and a molecular weight of 268.36 g/mol. Its IUPAC name is 5,5-dimethyl-2-(1H-pyrrolo[2,3-b]pyridine-5-carboximidoyl)cyclohexen-1-amine.
| Compound Name | 5,5-dimethyl-2-(1H-pyrrolo[2,3-b]pyridine-5-carboximidoyl)cyclohexen-1-amine |
|---|---|
| PubChem CID | 144999914 |
| Molecular Formula | C16H20N4 |
| Molecular Weight | 268.36 g/mol |
| Exact Mass | 268.17 |
| IUPAC Name | 5,5-dimethyl-2-(1H-pyrrolo[2,3-b]pyridine-5-carboximidoyl)cyclohexen-1-amine |
| SMILES | [H]/N=C(/C1=C(N)CC(C)(C)CC1)c1cnc2[nH]ccc2c1 |
| InChI | InChI=1S/C16H20N4/c1-16(2)5-3-12(13(17)8-16)14(18)11-7-10-4-6-19-15(10)20-9-11/h4,6-7,9,18H,3,5,8,17H2,1-2H3,(H,19,20)/b18-14+ |
| InChIKey | FHYQGJVSHDSYJZ-NBVRZTHBSA-N |
| XLogP | 3.35 |
| TPSA | 78.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.36 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|