C19H26FN5 — CID 145000022
4-(6,6-dimethyl-1,4,5,7-tetrahydroindazol-3-yl)-6-fluoro-N-(pyrrolidin-3-ylmethyl)pyridin-2-amine (PubChem CID 145000022) has the molecular formula C19H26FN5 and a molecular weight of 343.45 g/mol. Its IUPAC name is 4-(6,6-dimethyl-1,4,5,7-tetrahydroindazol-3-yl)-6-fluoro-N-(pyrrolidin-3-ylmethyl)pyridin-2-amine.
| Compound Name | 4-(6,6-dimethyl-1,4,5,7-tetrahydroindazol-3-yl)-6-fluoro-N-(pyrrolidin-3-ylmethyl)pyridin-2-amine |
|---|---|
| PubChem CID | 145000022 |
| Molecular Formula | C19H26FN5 |
| Molecular Weight | 343.45 g/mol |
| Exact Mass | 343.22 |
| IUPAC Name | 4-(6,6-dimethyl-1,4,5,7-tetrahydroindazol-3-yl)-6-fluoro-N-(pyrrolidin-3-ylmethyl)pyridin-2-amine |
| SMILES | CC1(C)CCc2c(-c3cc(F)nc(NCC4CCNC4)c3)n[nH]c2C1 |
| InChI | InChI=1S/C19H26FN5/c1-19(2)5-3-14-15(9-19)24-25-18(14)13-7-16(20)23-17(8-13)22-11-12-4-6-21-10-12/h7-8,12,21H,3-6,9-11H2,1-2H3,(H,22,23)(H,24,25) |
| InChIKey | DLJYGXQVQLRQAM-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 65.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.45 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|