C24H26FN5 — CID 145000212
4-(6,6-dimethyl-1,4,5,7-tetrahydroindazol-3-yl)-6-fluoro-N-[(1-methylindol-2-yl)methyl]pyridin-2-amine (PubChem CID 145000212) has the molecular formula C24H26FN5 and a molecular weight of 403.51 g/mol. Its IUPAC name is 4-(6,6-dimethyl-1,4,5,7-tetrahydroindazol-3-yl)-6-fluoro-N-[(1-methylindol-2-yl)methyl]pyridin-2-amine.
| Compound Name | 4-(6,6-dimethyl-1,4,5,7-tetrahydroindazol-3-yl)-6-fluoro-N-[(1-methylindol-2-yl)methyl]pyridin-2-amine |
|---|---|
| PubChem CID | 145000212 |
| Molecular Formula | C24H26FN5 |
| Molecular Weight | 403.51 g/mol |
| Exact Mass | 403.22 |
| IUPAC Name | 4-(6,6-dimethyl-1,4,5,7-tetrahydroindazol-3-yl)-6-fluoro-N-[(1-methylindol-2-yl)methyl]pyridin-2-amine |
| SMILES | Cn1c(CNc2cc(-c3n[nH]c4c3CCC(C)(C)C4)cc(F)n2)cc2ccccc21 |
| InChI | InChI=1S/C24H26FN5/c1-24(2)9-8-18-19(13-24)28-29-23(18)16-11-21(25)27-22(12-16)26-14-17-10-15-6-4-5-7-20(15)30(17)3/h4-7,10-12H,8-9,13-14H2,1-3H3,(H,26,27)(H,28,29) |
| InChIKey | SNWQIFYLCAQNTF-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 58.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.51 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|