C22H23F4N5O — CID 145000317
4-(6,6-dimethyl-1,4,5,7-tetrahydroindazol-3-yl)-6-fluoro-N-[[6-(2,2,2-trifluoroethoxy)-3-pyridinyl]methyl]pyridin-2-amine (PubChem CID 145000317) has the molecular formula C22H23F4N5O and a molecular weight of 449.45 g/mol. Its IUPAC name is 4-(6,6-dimethyl-1,4,5,7-tetrahydroindazol-3-yl)-6-fluoro-N-[[6-(2,2,2-trifluoroethoxy)-3-pyridinyl]methyl]pyridin-2-amine.
| Compound Name | 4-(6,6-dimethyl-1,4,5,7-tetrahydroindazol-3-yl)-6-fluoro-N-[[6-(2,2,2-trifluoroethoxy)-3-pyridinyl]methyl]pyridin-2-amine |
|---|---|
| PubChem CID | 145000317 |
| Molecular Formula | C22H23F4N5O |
| Molecular Weight | 449.45 g/mol |
| Exact Mass | 449.18 |
| IUPAC Name | 4-(6,6-dimethyl-1,4,5,7-tetrahydroindazol-3-yl)-6-fluoro-N-[[6-(2,2,2-trifluoroethoxy)-3-pyridinyl]methyl]pyridin-2-amine |
| SMILES | CC1(C)CCc2c(-c3cc(F)nc(NCc4ccc(OCC(F)(F)F)nc4)c3)n[nH]c2C1 |
| InChI | InChI=1S/C22H23F4N5O/c1-21(2)6-5-15-16(9-21)30-31-20(15)14-7-17(23)29-18(8-14)27-10-13-3-4-19(28-11-13)32-12-22(24,25)26/h3-4,7-8,11H,5-6,9-10,12H2,1-2H3,(H,27,29)(H,30,31) |
| InChIKey | GUQLTDOTTRUQJE-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 75.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.45 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|