C19H25FN4O — CID 145000539
4-(6,6-dimethyl-1,4,5,7-tetrahydroindazol-3-yl)-6-fluoro-N-(oxolan-3-ylmethyl)pyridin-2-amine (PubChem CID 145000539) has the molecular formula C19H25FN4O and a molecular weight of 344.43 g/mol. Its IUPAC name is 4-(6,6-dimethyl-1,4,5,7-tetrahydroindazol-3-yl)-6-fluoro-N-(oxolan-3-ylmethyl)pyridin-2-amine.
| Compound Name | 4-(6,6-dimethyl-1,4,5,7-tetrahydroindazol-3-yl)-6-fluoro-N-(oxolan-3-ylmethyl)pyridin-2-amine |
|---|---|
| PubChem CID | 145000539 |
| Molecular Formula | C19H25FN4O |
| Molecular Weight | 344.43 g/mol |
| Exact Mass | 344.20 |
| IUPAC Name | 4-(6,6-dimethyl-1,4,5,7-tetrahydroindazol-3-yl)-6-fluoro-N-(oxolan-3-ylmethyl)pyridin-2-amine |
| SMILES | CC1(C)CCc2c(-c3cc(F)nc(NCC4CCOC4)c3)n[nH]c2C1 |
| InChI | InChI=1S/C19H25FN4O/c1-19(2)5-3-14-15(9-19)23-24-18(14)13-7-16(20)22-17(8-13)21-10-12-4-6-25-11-12/h7-8,12H,3-6,9-11H2,1-2H3,(H,21,22)(H,23,24) |
| InChIKey | QTLCHZNCNFNUOP-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 62.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.43 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|