C18H13NO2S — CID 145000884
4-(2-nitrocyclohexa-2,4-dien-1-yl)dibenzothiophene (PubChem CID 145000884) has the molecular formula C18H13NO2S and a molecular weight of 307.37 g/mol. Its IUPAC name is 4-(2-nitrocyclohexa-2,4-dien-1-yl)dibenzothiophene.
| Compound Name | 4-(2-nitrocyclohexa-2,4-dien-1-yl)dibenzothiophene |
|---|---|
| PubChem CID | 145000884 |
| Molecular Formula | C18H13NO2S |
| Molecular Weight | 307.37 g/mol |
| Exact Mass | 307.07 |
| IUPAC Name | 4-(2-nitrocyclohexa-2,4-dien-1-yl)dibenzothiophene |
| SMILES | O=[N+]([O-])C1=CC=CCC1c1cccc2c1sc1ccccc12 |
| InChI | InChI=1S/C18H13NO2S/c20-19(21)16-10-3-1-6-12(16)14-8-5-9-15-13-7-2-4-11-17(13)22-18(14)15/h1-5,7-12H,6H2 |
| InChIKey | MCNGMYPFAPDPEB-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 43.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.37 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|