About ethane;1-[(3Z)-penta-1,3-dien-3-yl]-1-[(Z)-prop-1-enyl]hydrazine
ethane;1-[(3Z)-penta-1,3-dien-3-yl]-1-[(Z)-prop-1-enyl]hydrazine (PubChem CID 145001437) has the molecular formula C14H32N2
and a molecular weight of 228.42 g/mol. Its IUPAC name is ethane;1-[(3Z)-penta-1,3-dien-3-yl]-1-[(Z)-prop-1-enyl]hydrazine.
Molecular Properties
| Compound Name | ethane;1-[(3Z)-penta-1,3-dien-3-yl]-1-[(Z)-prop-1-enyl]hydrazine |
| PubChem CID | 145001437 |
| Molecular Formula | C14H32N2 |
| Molecular Weight | 228.42 g/mol |
| Exact Mass | 228.26 |
| IUPAC Name | ethane;1-[(3Z)-penta-1,3-dien-3-yl]-1-[(Z)-prop-1-enyl]hydrazine |
| SMILES | C=C/C(=C/C)N(N)/C=C\C.CC.CC.CC |
| InChI | InChI=1S/C8H14N2.3C2H6/c1-4-7-10(9)8(5-2)6-3;3*1-2/h4-7H,2,9H2,1,3H3;3*1-2H3/b7-4-,8-6-;;; |
| InChIKey | KZCYJAKLAWUQIA-IIUSMAINSA-N |
| XLogP | 4.86 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 228.42 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze ethane;1-[(3Z)-penta-1,3-dien-3-yl]-1-[(Z)-prop-1-enyl]hydrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;1-[(3Z)-penta-1,3-dien-3-yl]-1-[(Z)-prop-1-enyl]hydrazine?
The IUPAC name of ethane;1-[(3Z)-penta-1,3-dien-3-yl]-1-[(Z)-prop-1-enyl]hydrazine (CID 145001437) is ethane;1-[(3Z)-penta-1,3-dien-3-yl]-1-[(Z)-prop-1-enyl]hydrazine.
What is the SMILES notation for ethane;1-[(3Z)-penta-1,3-dien-3-yl]-1-[(Z)-prop-1-enyl]hydrazine?
The canonical SMILES for ethane;1-[(3Z)-penta-1,3-dien-3-yl]-1-[(Z)-prop-1-enyl]hydrazine is C=C/C(=C/C)N(N)/C=C\C.CC.CC.CC.
What is the InChIKey of ethane;1-[(3Z)-penta-1,3-dien-3-yl]-1-[(Z)-prop-1-enyl]hydrazine?
The InChIKey is KZCYJAKLAWUQIA-IIUSMAINSA-N. The full InChI is InChI=1S/C8H14N2.3C2H6/c1-4-7-10(9)8(5-2)6-3;3*1-2/h4-7H,2,9H2,1,3H3;3*1-2H3/b7-4-,8-6-;;;.
What are the key properties of ethane;1-[(3Z)-penta-1,3-dien-3-yl]-1-[(Z)-prop-1-enyl]hydrazine?
ethane;1-[(3Z)-penta-1,3-dien-3-yl]-1-[(Z)-prop-1-enyl]hydrazine has a molecular weight of 228.42 g/mol, XLogP of 4.86, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;1-[(3Z)-penta-1,3-dien-3-yl]-1-[(Z)-prop-1-enyl]hydrazine is sourced from PubChem (CID 145001437), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).