C25H27FN4O2 — CID 145002121
(2Z)-3-fluoro-N,2-dimethylpenta-2,4-dien-1-amine;6-[(4-formyl-2-pyridinyl)methyl]-3-methylquinoline-8-carboxamide (PubChem CID 145002121) has the molecular formula C25H27FN4O2 and a molecular weight of 434.52 g/mol. Its IUPAC name is (2Z)-3-fluoro-N,2-dimethylpenta-2,4-dien-1-amine;6-[(4-formyl-2-pyridinyl)methyl]-3-methylquinoline-8-carboxamide.
| Compound Name | (2Z)-3-fluoro-N,2-dimethylpenta-2,4-dien-1-amine;6-[(4-formyl-2-pyridinyl)methyl]-3-methylquinoline-8-carboxamide |
|---|---|
| PubChem CID | 145002121 |
| Molecular Formula | C25H27FN4O2 |
| Molecular Weight | 434.52 g/mol |
| Exact Mass | 434.21 |
| IUPAC Name | (2Z)-3-fluoro-N,2-dimethylpenta-2,4-dien-1-amine;6-[(4-formyl-2-pyridinyl)methyl]-3-methylquinoline-8-carboxamide |
| SMILES | C=C/C(F)=C(\C)CNC.Cc1cnc2c(C(N)=O)cc(Cc3cc(C=O)ccn3)cc2c1 |
| InChI | InChI=1S/C18H15N3O2.C7H12FN/c1-11-4-14-5-13(7-15-6-12(10-22)2-3-20-15)8-16(18(19)23)17(14)21-9-11;1-4-7(8)6(2)5-9-3/h2-6,8-10H,7H2,1H3,(H2,19,23);4,9H,1,5H2,2-3H3/b;7-6- |
| InChIKey | JNHMUNVATHDAGH-VDXOJYAPSA-N |
| XLogP | 4.08 |
| TPSA | 97.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.52 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|