C21H18N4O3 — CID 145002388
methyl 6-[5-(6-acetyl-2-pyridinyl)-2-methanimidoylanilino]pyridine-2-carboxylate (PubChem CID 145002388) has the molecular formula C21H18N4O3 and a molecular weight of 374.40 g/mol. Its IUPAC name is methyl 6-[5-(6-acetyl-2-pyridinyl)-2-methanimidoylanilino]pyridine-2-carboxylate.
| Compound Name | methyl 6-[5-(6-acetyl-2-pyridinyl)-2-methanimidoylanilino]pyridine-2-carboxylate |
|---|---|
| PubChem CID | 145002388 |
| Molecular Formula | C21H18N4O3 |
| Molecular Weight | 374.40 g/mol |
| Exact Mass | 374.14 |
| IUPAC Name | methyl 6-[5-(6-acetyl-2-pyridinyl)-2-methanimidoylanilino]pyridine-2-carboxylate |
| SMILES | [H]/N=C/c1ccc(-c2cccc(C(C)=O)n2)cc1Nc1cccc(C(=O)OC)n1 |
| InChI | InChI=1S/C21H18N4O3/c1-13(26)16-5-3-6-17(23-16)14-9-10-15(12-22)19(11-14)25-20-8-4-7-18(24-20)21(27)28-2/h3-12,22H,1-2H3,(H,24,25)/b22-12+ |
| InChIKey | DTONIEOIWIVDPL-WSDLNYQXSA-N |
| XLogP | 3.87 |
| TPSA | 105.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.40 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|