C16H18BrN3 — CID 145002747
6-bromo-1-(4,6-dimethyl-2-pyridinyl)indazole;ethane (PubChem CID 145002747) has the molecular formula C16H18BrN3 and a molecular weight of 332.25 g/mol. Its IUPAC name is 6-bromo-1-(4,6-dimethyl-2-pyridinyl)indazole;ethane.
| Compound Name | 6-bromo-1-(4,6-dimethyl-2-pyridinyl)indazole;ethane |
|---|---|
| PubChem CID | 145002747 |
| Molecular Formula | C16H18BrN3 |
| Molecular Weight | 332.25 g/mol |
| Exact Mass | 331.07 |
| IUPAC Name | 6-bromo-1-(4,6-dimethyl-2-pyridinyl)indazole;ethane |
| SMILES | CC.Cc1cc(C)nc(-n2ncc3ccc(Br)cc32)c1 |
| InChI | InChI=1S/C14H12BrN3.C2H6/c1-9-5-10(2)17-14(6-9)18-13-7-12(15)4-3-11(13)8-16-18;1-2/h3-8H,1-2H3;1-2H3 |
| InChIKey | XWHMMCPPJMNTTA-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.25 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |