C7H10FN — CID 145003766
3-fluoro-1,6-dimethyl-2H-pyridine (PubChem CID 145003766) has the molecular formula C7H10FN and a molecular weight of 127.16 g/mol. Its IUPAC name is 3-fluoro-1,6-dimethyl-2H-pyridine.
| Compound Name | 3-fluoro-1,6-dimethyl-2H-pyridine |
|---|---|
| PubChem CID | 145003766 |
| Molecular Formula | C7H10FN |
| Molecular Weight | 127.16 g/mol |
| Exact Mass | 127.08 |
| IUPAC Name | 3-fluoro-1,6-dimethyl-2H-pyridine |
| SMILES | CC1=CC=C(F)CN1C |
| InChI | InChI=1S/C7H10FN/c1-6-3-4-7(8)5-9(6)2/h3-4H,5H2,1-2H3 |
| InChIKey | CMTREEIIBMNJNW-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 127.16 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |