About 4-buta-1,3-dien-2-yl-1-methyl-2-[(2Z)-penta-2,4-dienyl]benzene
4-buta-1,3-dien-2-yl-1-methyl-2-[(2Z)-penta-2,4-dienyl]benzene (PubChem CID 145004031) has the molecular formula C16H18
and a molecular weight of 210.32 g/mol. Its IUPAC name is 4-buta-1,3-dien-2-yl-1-methyl-2-[(2Z)-penta-2,4-dienyl]benzene.
Molecular Properties
| Compound Name | 4-buta-1,3-dien-2-yl-1-methyl-2-[(2Z)-penta-2,4-dienyl]benzene |
| PubChem CID | 145004031 |
| Molecular Formula | C16H18 |
| Molecular Weight | 210.32 g/mol |
| Exact Mass | 210.14 |
| IUPAC Name | 4-buta-1,3-dien-2-yl-1-methyl-2-[(2Z)-penta-2,4-dienyl]benzene |
| SMILES | C=C/C=C\Cc1cc(C(=C)C=C)ccc1C |
| InChI | InChI=1S/C16H18/c1-5-7-8-9-15-12-16(13(3)6-2)11-10-14(15)4/h5-8,10-12H,1-3,9H2,4H3/b8-7- |
| InChIKey | GCBYPPRXAYNJOV-FPLPWBNLSA-N |
| XLogP | 4.48 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.32 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 4-buta-1,3-dien-2-yl-1-methyl-2-[(2Z)-penta-2,4-dienyl]benzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-buta-1,3-dien-2-yl-1-methyl-2-[(2Z)-penta-2,4-dienyl]benzene?
The IUPAC name of 4-buta-1,3-dien-2-yl-1-methyl-2-[(2Z)-penta-2,4-dienyl]benzene (CID 145004031) is 4-buta-1,3-dien-2-yl-1-methyl-2-[(2Z)-penta-2,4-dienyl]benzene.
What is the SMILES notation for 4-buta-1,3-dien-2-yl-1-methyl-2-[(2Z)-penta-2,4-dienyl]benzene?
The canonical SMILES for 4-buta-1,3-dien-2-yl-1-methyl-2-[(2Z)-penta-2,4-dienyl]benzene is C=C/C=C\Cc1cc(C(=C)C=C)ccc1C.
What is the InChIKey of 4-buta-1,3-dien-2-yl-1-methyl-2-[(2Z)-penta-2,4-dienyl]benzene?
The InChIKey is GCBYPPRXAYNJOV-FPLPWBNLSA-N. The full InChI is InChI=1S/C16H18/c1-5-7-8-9-15-12-16(13(3)6-2)11-10-14(15)4/h5-8,10-12H,1-3,9H2,4H3/b8-7-.
What are the key properties of 4-buta-1,3-dien-2-yl-1-methyl-2-[(2Z)-penta-2,4-dienyl]benzene?
4-buta-1,3-dien-2-yl-1-methyl-2-[(2Z)-penta-2,4-dienyl]benzene has a molecular weight of 210.32 g/mol, XLogP of 4.48, 5 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 4-buta-1,3-dien-2-yl-1-methyl-2-[(2Z)-penta-2,4-dienyl]benzene is sourced from PubChem (CID 145004031), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).