About 4-(3,4-diazabicyclo[5.1.0]octa-1(8),5-dien-2-yl)benzonitrile
4-(3,4-diazabicyclo[5.1.0]octa-1(8),5-dien-2-yl)benzonitrile (PubChem CID 145004048) has the molecular formula C13H11N3
and a molecular weight of 209.25 g/mol. Its IUPAC name is 4-(3,4-diazabicyclo[5.1.0]octa-1(8),5-dien-2-yl)benzonitrile.
Molecular Properties
| Compound Name | 4-(3,4-diazabicyclo[5.1.0]octa-1(8),5-dien-2-yl)benzonitrile |
| PubChem CID | 145004048 |
| Molecular Formula | C13H11N3 |
| Molecular Weight | 209.25 g/mol |
| Exact Mass | 209.10 |
| IUPAC Name | 4-(3,4-diazabicyclo[5.1.0]octa-1(8),5-dien-2-yl)benzonitrile |
| SMILES | N#Cc1ccc(C2NNC=CC3C=C32)cc1 |
| InChI | InChI=1S/C13H11N3/c14-8-9-1-3-10(4-2-9)13-12-7-11(12)5-6-15-16-13/h1-7,11,13,15-16H |
| InChIKey | WZWZZRBNQDQVHZ-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 47.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 209.25 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 4-(3,4-diazabicyclo[5.1.0]octa-1(8),5-dien-2-yl)benzonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(3,4-diazabicyclo[5.1.0]octa-1(8),5-dien-2-yl)benzonitrile?
The IUPAC name of 4-(3,4-diazabicyclo[5.1.0]octa-1(8),5-dien-2-yl)benzonitrile (CID 145004048) is 4-(3,4-diazabicyclo[5.1.0]octa-1(8),5-dien-2-yl)benzonitrile.
What is the SMILES notation for 4-(3,4-diazabicyclo[5.1.0]octa-1(8),5-dien-2-yl)benzonitrile?
The canonical SMILES for 4-(3,4-diazabicyclo[5.1.0]octa-1(8),5-dien-2-yl)benzonitrile is N#Cc1ccc(C2NNC=CC3C=C32)cc1.
What is the InChIKey of 4-(3,4-diazabicyclo[5.1.0]octa-1(8),5-dien-2-yl)benzonitrile?
The InChIKey is WZWZZRBNQDQVHZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H11N3/c14-8-9-1-3-10(4-2-9)13-12-7-11(12)5-6-15-16-13/h1-7,11,13,15-16H.
What are the key properties of 4-(3,4-diazabicyclo[5.1.0]octa-1(8),5-dien-2-yl)benzonitrile?
4-(3,4-diazabicyclo[5.1.0]octa-1(8),5-dien-2-yl)benzonitrile has a molecular weight of 209.25 g/mol, XLogP of 1.78, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(3,4-diazabicyclo[5.1.0]octa-1(8),5-dien-2-yl)benzonitrile is sourced from PubChem (CID 145004048), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).