C22H31NO6 — CID 14500431
(Z)-but-2-enedioic acid;2-(2,3-dihydro-1H-inden-4-yloxy)-1-(1-ethylpiperidin-2-yl)ethanol (PubChem CID 14500431) has the molecular formula C22H31NO6 and a molecular weight of 405.49 g/mol. Its IUPAC name is (Z)-but-2-enedioic acid;2-(2,3-dihydro-1H-inden-4-yloxy)-1-(1-ethylpiperidin-2-yl)ethanol.
| Compound Name | (Z)-but-2-enedioic acid;2-(2,3-dihydro-1H-inden-4-yloxy)-1-(1-ethylpiperidin-2-yl)ethanol |
|---|---|
| PubChem CID | 14500431 |
| Molecular Formula | C22H31NO6 |
| Molecular Weight | 405.49 g/mol |
| Exact Mass | 405.22 |
| IUPAC Name | (Z)-but-2-enedioic acid;2-(2,3-dihydro-1H-inden-4-yloxy)-1-(1-ethylpiperidin-2-yl)ethanol |
| SMILES | CCN1CCCCC1C(O)COc1cccc2c1CCC2.O=C(O)/C=C\C(=O)O |
| InChI | InChI=1S/C18H27NO2.C4H4O4/c1-2-19-12-4-3-10-16(19)17(20)13-21-18-11-6-8-14-7-5-9-15(14)18;5-3(6)1-2-4(7)8/h6,8,11,16-17,20H,2-5,7,9-10,12-13H2,1H3;1-2H,(H,5,6)(H,7,8)/b;2-1- |
| InChIKey | RSGGXTWXJJIGLU-BTJKTKAUSA-N |
| XLogP | 2.50 |
| TPSA | 107.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.49 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|