About ethane;5-hydroxy-1H-pyrimidine-2,4-dione
ethane;5-hydroxy-1H-pyrimidine-2,4-dione (PubChem CID 145004805) has the molecular formula C6H10N2O3
and a molecular weight of 158.16 g/mol. Its IUPAC name is ethane;5-hydroxy-1H-pyrimidine-2,4-dione.
Molecular Properties
| Compound Name | ethane;5-hydroxy-1H-pyrimidine-2,4-dione |
| PubChem CID | 145004805 |
| Molecular Formula | C6H10N2O3 |
| Molecular Weight | 158.16 g/mol |
| Exact Mass | 158.07 |
| IUPAC Name | ethane;5-hydroxy-1H-pyrimidine-2,4-dione |
| SMILES | CC.O=c1[nH]cc(O)c(=O)[nH]1 |
| InChI | InChI=1S/C4H4N2O3.C2H6/c7-2-1-5-4(9)6-3(2)8;1-2/h1,7H,(H2,5,6,8,9);1-2H3 |
| InChIKey | XAVDRJPGRSJAIG-UHFFFAOYSA-N |
| XLogP | -0.20 |
| TPSA | 85.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 158.16 |
| LogP ≤ 5 | -0.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze ethane;5-hydroxy-1H-pyrimidine-2,4-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;5-hydroxy-1H-pyrimidine-2,4-dione?
The IUPAC name of ethane;5-hydroxy-1H-pyrimidine-2,4-dione (CID 145004805) is ethane;5-hydroxy-1H-pyrimidine-2,4-dione.
What is the SMILES notation for ethane;5-hydroxy-1H-pyrimidine-2,4-dione?
The canonical SMILES for ethane;5-hydroxy-1H-pyrimidine-2,4-dione is CC.O=c1[nH]cc(O)c(=O)[nH]1.
What is the InChIKey of ethane;5-hydroxy-1H-pyrimidine-2,4-dione?
The InChIKey is XAVDRJPGRSJAIG-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H4N2O3.C2H6/c7-2-1-5-4(9)6-3(2)8;1-2/h1,7H,(H2,5,6,8,9);1-2H3.
What are the key properties of ethane;5-hydroxy-1H-pyrimidine-2,4-dione?
ethane;5-hydroxy-1H-pyrimidine-2,4-dione has a molecular weight of 158.16 g/mol, XLogP of -0.20, 0 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;5-hydroxy-1H-pyrimidine-2,4-dione is sourced from PubChem (CID 145004805), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).