C20H28Cl2O2 — CID 145005121
1,2-dichloro-4-methylbenzene;5-ethyl-2,2,4-trimethyl-3H-pyran-6-one;prop-1-ene (PubChem CID 145005121) has the molecular formula C20H28Cl2O2 and a molecular weight of 371.35 g/mol. Its IUPAC name is 1,2-dichloro-4-methylbenzene;5-ethyl-2,2,4-trimethyl-3H-pyran-6-one;prop-1-ene.
| Compound Name | 1,2-dichloro-4-methylbenzene;5-ethyl-2,2,4-trimethyl-3H-pyran-6-one;prop-1-ene |
|---|---|
| PubChem CID | 145005121 |
| Molecular Formula | C20H28Cl2O2 |
| Molecular Weight | 371.35 g/mol |
| Exact Mass | 370.15 |
| IUPAC Name | 1,2-dichloro-4-methylbenzene;5-ethyl-2,2,4-trimethyl-3H-pyran-6-one;prop-1-ene |
| SMILES | C=CC.CCC1=C(C)CC(C)(C)OC1=O.Cc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C10H16O2.C7H6Cl2.C3H6/c1-5-8-7(2)6-10(3,4)12-9(8)11;1-5-2-3-6(8)7(9)4-5;1-3-2/h5-6H2,1-4H3;2-4H,1H3;3H,1H2,2H3 |
| InChIKey | CSNSCXCRZOPBSR-UHFFFAOYSA-N |
| XLogP | 6.93 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.35 |
| LogP ≤ 5 | 6.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|