About 3-methylbenzenethiol;1-[(5-methylpyrrolidin-3-yl)methyl]-5-(1H-pyrazol-4-yl)indole
3-methylbenzenethiol;1-[(5-methylpyrrolidin-3-yl)methyl]-5-(1H-pyrazol-4-yl)indole (PubChem CID 145005362) has the molecular formula C24H28N4S
and a molecular weight of 404.58 g/mol. Its IUPAC name is 3-methylbenzenethiol;1-[(5-methylpyrrolidin-3-yl)methyl]-5-(1H-pyrazol-4-yl)indole.
Molecular Properties
| Compound Name | 3-methylbenzenethiol;1-[(5-methylpyrrolidin-3-yl)methyl]-5-(1H-pyrazol-4-yl)indole |
| PubChem CID | 145005362 |
| Molecular Formula | C24H28N4S |
| Molecular Weight | 404.58 g/mol |
| Exact Mass | 404.20 |
| IUPAC Name | 3-methylbenzenethiol;1-[(5-methylpyrrolidin-3-yl)methyl]-5-(1H-pyrazol-4-yl)indole |
| SMILES | CC1CC(Cn2ccc3cc(-c4cn[nH]c4)ccc32)CN1.Cc1cccc(S)c1 |
| InChI | InChI=1S/C17H20N4.C7H8S/c1-12-6-13(8-18-12)11-21-5-4-15-7-14(2-3-17(15)21)16-9-19-20-10-16;1-6-3-2-4-7(8)5-6/h2-5,7,9-10,12-13,18H,6,8,11H2,1H3,(H,19,20);2-5,8H,1H3 |
| InChIKey | GXJDGATZSFBTCX-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 45.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 404.58 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 3-methylbenzenethiol;1-[(5-methylpyrrolidin-3-yl)methyl]-5-(1H-pyrazol-4-yl)indole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methylbenzenethiol;1-[(5-methylpyrrolidin-3-yl)methyl]-5-(1H-pyrazol-4-yl)indole?
The IUPAC name of 3-methylbenzenethiol;1-[(5-methylpyrrolidin-3-yl)methyl]-5-(1H-pyrazol-4-yl)indole (CID 145005362) is 3-methylbenzenethiol;1-[(5-methylpyrrolidin-3-yl)methyl]-5-(1H-pyrazol-4-yl)indole.
What is the SMILES notation for 3-methylbenzenethiol;1-[(5-methylpyrrolidin-3-yl)methyl]-5-(1H-pyrazol-4-yl)indole?
The canonical SMILES for 3-methylbenzenethiol;1-[(5-methylpyrrolidin-3-yl)methyl]-5-(1H-pyrazol-4-yl)indole is CC1CC(Cn2ccc3cc(-c4cn[nH]c4)ccc32)CN1.Cc1cccc(S)c1.
What is the InChIKey of 3-methylbenzenethiol;1-[(5-methylpyrrolidin-3-yl)methyl]-5-(1H-pyrazol-4-yl)indole?
The InChIKey is GXJDGATZSFBTCX-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H20N4.C7H8S/c1-12-6-13(8-18-12)11-21-5-4-15-7-14(2-3-17(15)21)16-9-19-20-10-16;1-6-3-2-4-7(8)5-6/h2-5,7,9-10,12-13,18H,6,8,11H2,1H3,(H,19,20);2-5,8H,1H3.
What are the key properties of 3-methylbenzenethiol;1-[(5-methylpyrrolidin-3-yl)methyl]-5-(1H-pyrazol-4-yl)indole?
3-methylbenzenethiol;1-[(5-methylpyrrolidin-3-yl)methyl]-5-(1H-pyrazol-4-yl)indole has a molecular weight of 404.58 g/mol, XLogP of 5.31, 3 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methylbenzenethiol;1-[(5-methylpyrrolidin-3-yl)methyl]-5-(1H-pyrazol-4-yl)indole is sourced from PubChem (CID 145005362), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).