C20H33BO2 — CID 145005978
2-[4-(4-ethylidenecyclohexyl)cyclohexen-1-yl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (PubChem CID 145005978) has the molecular formula C20H33BO2 and a molecular weight of 316.29 g/mol. Its IUPAC name is 2-[4-(4-ethylidenecyclohexyl)cyclohexen-1-yl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane.
| Compound Name | 2-[4-(4-ethylidenecyclohexyl)cyclohexen-1-yl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 145005978 |
| Molecular Formula | C20H33BO2 |
| Molecular Weight | 316.29 g/mol |
| Exact Mass | 316.26 |
| IUPAC Name | 2-[4-(4-ethylidenecyclohexyl)cyclohexen-1-yl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| SMILES | CC=C1CCC(C2CC=C(B3OC(C)(C)C(C)(C)O3)CC2)CC1 |
| InChI | InChI=1S/C20H33BO2/c1-6-15-7-9-16(10-8-15)17-11-13-18(14-12-17)21-22-19(2,3)20(4,5)23-21/h6,13,16-17H,7-12,14H2,1-5H3/b15-6- |
| InChIKey | OHDNRRQEFYOFPQ-UUASQNMZSA-N |
| XLogP | 5.48 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.29 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|