C23H41BO2 — CID 145006030
4,4,5,5-tetramethyl-2-[[4-(3-methyl-4-propylcyclohexyl)cyclohexen-1-yl]methyl]-1,3,2-dioxaborolane (PubChem CID 145006030) has the molecular formula C23H41BO2 and a molecular weight of 360.39 g/mol. Its IUPAC name is 4,4,5,5-tetramethyl-2-[[4-(3-methyl-4-propylcyclohexyl)cyclohexen-1-yl]methyl]-1,3,2-dioxaborolane.
| Compound Name | 4,4,5,5-tetramethyl-2-[[4-(3-methyl-4-propylcyclohexyl)cyclohexen-1-yl]methyl]-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 145006030 |
| Molecular Formula | C23H41BO2 |
| Molecular Weight | 360.39 g/mol |
| Exact Mass | 360.32 |
| IUPAC Name | 4,4,5,5-tetramethyl-2-[[4-(3-methyl-4-propylcyclohexyl)cyclohexen-1-yl]methyl]-1,3,2-dioxaborolane |
| SMILES | CCCC1CCC(C2CC=C(CB3OC(C)(C)C(C)(C)O3)CC2)CC1C |
| InChI | InChI=1S/C23H41BO2/c1-7-8-19-13-14-21(15-17(19)2)20-11-9-18(10-12-20)16-24-25-22(3,4)23(5,6)26-24/h9,17,19-21H,7-8,10-16H2,1-6H3 |
| InChIKey | XQWDVGGTQKTKCC-UHFFFAOYSA-N |
| XLogP | 6.66 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.39 |
| LogP ≤ 5 | 6.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|