About ethane;4-methyl-1-[1-(oxetan-3-yl)piperidin-4-yl]piperidine
ethane;4-methyl-1-[1-(oxetan-3-yl)piperidin-4-yl]piperidine (PubChem CID 145006332) has the molecular formula C16H32N2O
and a molecular weight of 268.44 g/mol. Its IUPAC name is ethane;4-methyl-1-[1-(oxetan-3-yl)piperidin-4-yl]piperidine.
Molecular Properties
| Compound Name | ethane;4-methyl-1-[1-(oxetan-3-yl)piperidin-4-yl]piperidine |
| PubChem CID | 145006332 |
| Molecular Formula | C16H32N2O |
| Molecular Weight | 268.44 g/mol |
| Exact Mass | 268.25 |
| IUPAC Name | ethane;4-methyl-1-[1-(oxetan-3-yl)piperidin-4-yl]piperidine |
| SMILES | CC.CC1CCN(C2CCN(C3COC3)CC2)CC1 |
| InChI | InChI=1S/C14H26N2O.C2H6/c1-12-2-6-15(7-3-12)13-4-8-16(9-5-13)14-10-17-11-14;1-2/h12-14H,2-11H2,1H3;1-2H3 |
| InChIKey | ICKRQVKPNROQRO-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 15.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 268.44 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze ethane;4-methyl-1-[1-(oxetan-3-yl)piperidin-4-yl]piperidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;4-methyl-1-[1-(oxetan-3-yl)piperidin-4-yl]piperidine?
The IUPAC name of ethane;4-methyl-1-[1-(oxetan-3-yl)piperidin-4-yl]piperidine (CID 145006332) is ethane;4-methyl-1-[1-(oxetan-3-yl)piperidin-4-yl]piperidine.
What is the SMILES notation for ethane;4-methyl-1-[1-(oxetan-3-yl)piperidin-4-yl]piperidine?
The canonical SMILES for ethane;4-methyl-1-[1-(oxetan-3-yl)piperidin-4-yl]piperidine is CC.CC1CCN(C2CCN(C3COC3)CC2)CC1.
What is the InChIKey of ethane;4-methyl-1-[1-(oxetan-3-yl)piperidin-4-yl]piperidine?
The InChIKey is ICKRQVKPNROQRO-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H26N2O.C2H6/c1-12-2-6-15(7-3-12)13-4-8-16(9-5-13)14-10-17-11-14;1-2/h12-14H,2-11H2,1H3;1-2H3.
What are the key properties of ethane;4-methyl-1-[1-(oxetan-3-yl)piperidin-4-yl]piperidine?
ethane;4-methyl-1-[1-(oxetan-3-yl)piperidin-4-yl]piperidine has a molecular weight of 268.44 g/mol, XLogP of 2.61, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;4-methyl-1-[1-(oxetan-3-yl)piperidin-4-yl]piperidine is sourced from PubChem (CID 145006332), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).