About 4-butan-2-yl-1-methyl-6,7-dihydro-5H-cyclopenta[c]pyridine
4-butan-2-yl-1-methyl-6,7-dihydro-5H-cyclopenta[c]pyridine (PubChem CID 145006512) has the molecular formula C13H19N
and a molecular weight of 189.30 g/mol. Its IUPAC name is 4-butan-2-yl-1-methyl-6,7-dihydro-5H-cyclopenta[c]pyridine.
Molecular Properties
| Compound Name | 4-butan-2-yl-1-methyl-6,7-dihydro-5H-cyclopenta[c]pyridine |
| PubChem CID | 145006512 |
| Molecular Formula | C13H19N |
| Molecular Weight | 189.30 g/mol |
| Exact Mass | 189.15 |
| IUPAC Name | 4-butan-2-yl-1-methyl-6,7-dihydro-5H-cyclopenta[c]pyridine |
| SMILES | CCC(C)c1cnc(C)c2c1CCC2 |
| InChI | InChI=1S/C13H19N/c1-4-9(2)13-8-14-10(3)11-6-5-7-12(11)13/h8-9H,4-7H2,1-3H3 |
| InChIKey | XAMSZYIWMPTXQY-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 189.30 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 4-butan-2-yl-1-methyl-6,7-dihydro-5H-cyclopenta[c]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-butan-2-yl-1-methyl-6,7-dihydro-5H-cyclopenta[c]pyridine?
The IUPAC name of 4-butan-2-yl-1-methyl-6,7-dihydro-5H-cyclopenta[c]pyridine (CID 145006512) is 4-butan-2-yl-1-methyl-6,7-dihydro-5H-cyclopenta[c]pyridine.
What is the SMILES notation for 4-butan-2-yl-1-methyl-6,7-dihydro-5H-cyclopenta[c]pyridine?
The canonical SMILES for 4-butan-2-yl-1-methyl-6,7-dihydro-5H-cyclopenta[c]pyridine is CCC(C)c1cnc(C)c2c1CCC2.
What is the InChIKey of 4-butan-2-yl-1-methyl-6,7-dihydro-5H-cyclopenta[c]pyridine?
The InChIKey is XAMSZYIWMPTXQY-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H19N/c1-4-9(2)13-8-14-10(3)11-6-5-7-12(11)13/h8-9H,4-7H2,1-3H3.
What are the key properties of 4-butan-2-yl-1-methyl-6,7-dihydro-5H-cyclopenta[c]pyridine?
4-butan-2-yl-1-methyl-6,7-dihydro-5H-cyclopenta[c]pyridine has a molecular weight of 189.30 g/mol, XLogP of 3.39, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-butan-2-yl-1-methyl-6,7-dihydro-5H-cyclopenta[c]pyridine is sourced from PubChem (CID 145006512), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).