C8H16IN3O — CID 145006670
4-(ethylamino)-1-iodopiperidine-4-carboxamide (PubChem CID 145006670) has the molecular formula C8H16IN3O and a molecular weight of 297.14 g/mol. Its IUPAC name is 4-(ethylamino)-1-iodopiperidine-4-carboxamide.
| Compound Name | 4-(ethylamino)-1-iodopiperidine-4-carboxamide |
|---|---|
| PubChem CID | 145006670 |
| Molecular Formula | C8H16IN3O |
| Molecular Weight | 297.14 g/mol |
| Exact Mass | 297.03 |
| IUPAC Name | 4-(ethylamino)-1-iodopiperidine-4-carboxamide |
| SMILES | CCNC1(C(N)=O)CCN(I)CC1 |
| InChI | InChI=1S/C8H16IN3O/c1-2-11-8(7(10)13)3-5-12(9)6-4-8/h11H,2-6H2,1H3,(H2,10,13) |
| InChIKey | OJEQDDHGGZTEPM-UHFFFAOYSA-N |
| XLogP | 0.27 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.14 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|