C56H38Br2N6S2 — CID 145007107
bis(2-(8-bromodibenzothiophen-1-yl)-4,6-diphenyl-1,3,5-triazine);ethane (PubChem CID 145007107) has the molecular formula C56H38Br2N6S2 and a molecular weight of 1018.90 g/mol. Its IUPAC name is bis(2-(8-bromodibenzothiophen-1-yl)-4,6-diphenyl-1,3,5-triazine);ethane.
| Compound Name | bis(2-(8-bromodibenzothiophen-1-yl)-4,6-diphenyl-1,3,5-triazine);ethane |
|---|---|
| PubChem CID | 145007107 |
| Molecular Formula | C56H38Br2N6S2 |
| Molecular Weight | 1018.90 g/mol |
| Exact Mass | 1016.10 |
| IUPAC Name | bis(2-(8-bromodibenzothiophen-1-yl)-4,6-diphenyl-1,3,5-triazine);ethane |
| SMILES | Brc1ccc2sc3cccc(-c4nc(-c5ccccc5)nc(-c5ccccc5)n4)c3c2c1.Brc1ccc2sc3cccc(-c4nc(-c5ccccc5)nc(-c5ccccc5)n4)c3c2c1.CC |
| InChI | InChI=1S/2C27H16BrN3S.C2H6/c2*28-19-14-15-22-21(16-19)24-20(12-7-13-23(24)32-22)27-30-25(17-8-3-1-4-9-17)29-26(31-27)18-10-5-2-6-11-18;1-2/h2*1-16H;1-2H3 |
| InChIKey | LAIGQHUORANQOX-UHFFFAOYSA-N |
| XLogP | 17.03 |
| TPSA | 77.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 66 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1018.90 |
| LogP ≤ 5 | 17.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |