C12H24N6 — CID 145008054
ethane;N-methyl-1-(1H-pyrazol-4-yl)methanamine;(2-methylpyrazol-3-yl)methanamine (PubChem CID 145008054) has the molecular formula C12H24N6 and a molecular weight of 252.37 g/mol. Its IUPAC name is ethane;N-methyl-1-(1H-pyrazol-4-yl)methanamine;(2-methylpyrazol-3-yl)methanamine.
| Compound Name | ethane;N-methyl-1-(1H-pyrazol-4-yl)methanamine;(2-methylpyrazol-3-yl)methanamine |
|---|---|
| PubChem CID | 145008054 |
| Molecular Formula | C12H24N6 |
| Molecular Weight | 252.37 g/mol |
| Exact Mass | 252.21 |
| IUPAC Name | ethane;N-methyl-1-(1H-pyrazol-4-yl)methanamine;(2-methylpyrazol-3-yl)methanamine |
| SMILES | CC.CNCc1cn[nH]c1.Cn1nccc1CN |
| InChI | InChI=1S/2C5H9N3.C2H6/c1-6-2-5-3-7-8-4-5;1-8-5(4-6)2-3-7-8;1-2/h3-4,6H,2H2,1H3,(H,7,8);2-3H,4,6H2,1H3;1-2H3 |
| InChIKey | DVECXAGQVUURLO-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 84.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.37 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |