C19H23F3N3O7P — CID 145008653
propan-2-yl 2-[[[(2E,4Z)-hepta-2,4,6-trien-3-yl]oxy-[[3-nitro-5-(trifluoromethyl)-2-pyridinyl]oxy]phosphoryl]amino]propanoate (PubChem CID 145008653) has the molecular formula C19H23F3N3O7P and a molecular weight of 493.38 g/mol. Its IUPAC name is propan-2-yl 2-[[[(2E,4Z)-hepta-2,4,6-trien-3-yl]oxy-[[3-nitro-5-(trifluoromethyl)-2-pyridinyl]oxy]phosphoryl]amino]propanoate.
| Compound Name | propan-2-yl 2-[[[(2E,4Z)-hepta-2,4,6-trien-3-yl]oxy-[[3-nitro-5-(trifluoromethyl)-2-pyridinyl]oxy]phosphoryl]amino]propanoate |
|---|---|
| PubChem CID | 145008653 |
| Molecular Formula | C19H23F3N3O7P |
| Molecular Weight | 493.38 g/mol |
| Exact Mass | 493.12 |
| IUPAC Name | propan-2-yl 2-[[[(2E,4Z)-hepta-2,4,6-trien-3-yl]oxy-[[3-nitro-5-(trifluoromethyl)-2-pyridinyl]oxy]phosphoryl]amino]propanoate |
| SMILES | C=C/C=C\C(=C/C)OP(=O)(NC(C)C(=O)OC(C)C)Oc1ncc(C(F)(F)F)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C19H23F3N3O7P/c1-6-8-9-15(7-2)31-33(29,24-13(5)18(26)30-12(3)4)32-17-16(25(27)28)10-14(11-23-17)19(20,21)22/h6-13H,1H2,2-5H3,(H,24,29)/b9-8-,15-7+ |
| InChIKey | AAYQRMTXZWHKTQ-WNVJXHEZSA-N |
| XLogP | 5.09 |
| TPSA | 129.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.38 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|