C21H21N3O2 — CID 1450089
1-benzyl-3-[1-[(4-methylphenyl)methyl]-2-oxo-3-pyridinyl]urea (PubChem CID 1450089) has the molecular formula C21H21N3O2 and a molecular weight of 347.42 g/mol. Its IUPAC name is 1-benzyl-3-[1-[(4-methylphenyl)methyl]-2-oxo-3-pyridinyl]urea.
| Compound Name | 1-benzyl-3-[1-[(4-methylphenyl)methyl]-2-oxo-3-pyridinyl]urea |
|---|---|
| PubChem CID | 1450089 |
| Molecular Formula | C21H21N3O2 |
| Molecular Weight | 347.42 g/mol |
| Exact Mass | 347.16 |
| IUPAC Name | 1-benzyl-3-[1-[(4-methylphenyl)methyl]-2-oxo-3-pyridinyl]urea |
| SMILES | Cc1ccc(Cn2cccc(NC(=O)NCc3ccccc3)c2=O)cc1 |
| InChI | InChI=1S/C21H21N3O2/c1-16-9-11-18(12-10-16)15-24-13-5-8-19(20(24)25)23-21(26)22-14-17-6-3-2-4-7-17/h2-13H,14-15H2,1H3,(H2,22,23,26) |
| InChIKey | PLDTZERDBKVUMC-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 63.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.42 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |