C20H34F2O2 — CID 145009682
1-[(4Z)-4,5-difluoro-6-methoxy-3-methylidenehepta-4,6-dien-2-yl]oxy-2,3,6-trimethyloctane (PubChem CID 145009682) has the molecular formula C20H34F2O2 and a molecular weight of 344.49 g/mol. Its IUPAC name is 1-[(4Z)-4,5-difluoro-6-methoxy-3-methylidenehepta-4,6-dien-2-yl]oxy-2,3,6-trimethyloctane.
| Compound Name | 1-[(4Z)-4,5-difluoro-6-methoxy-3-methylidenehepta-4,6-dien-2-yl]oxy-2,3,6-trimethyloctane |
|---|---|
| PubChem CID | 145009682 |
| Molecular Formula | C20H34F2O2 |
| Molecular Weight | 344.49 g/mol |
| Exact Mass | 344.25 |
| IUPAC Name | 1-[(4Z)-4,5-difluoro-6-methoxy-3-methylidenehepta-4,6-dien-2-yl]oxy-2,3,6-trimethyloctane |
| SMILES | C=C(OC)/C(F)=C(/F)C(=C)C(C)OCC(C)C(C)CCC(C)CC |
| InChI | InChI=1S/C20H34F2O2/c1-9-13(2)10-11-14(3)15(4)12-24-17(6)16(5)19(21)20(22)18(7)23-8/h13-15,17H,5,7,9-12H2,1-4,6,8H3/b20-19- |
| InChIKey | XXXZQVZFZYYLSQ-VXPUYCOJSA-N |
| XLogP | 6.36 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.49 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|