C21H18N4O2 — CID 1450101
1-(3-cyanophenyl)-3-[1-[(4-methylphenyl)methyl]-2-oxo-3-pyridinyl]urea (PubChem CID 1450101) has the molecular formula C21H18N4O2 and a molecular weight of 358.40 g/mol. Its IUPAC name is 1-(3-cyanophenyl)-3-[1-[(4-methylphenyl)methyl]-2-oxo-3-pyridinyl]urea.
| Compound Name | 1-(3-cyanophenyl)-3-[1-[(4-methylphenyl)methyl]-2-oxo-3-pyridinyl]urea |
|---|---|
| PubChem CID | 1450101 |
| Molecular Formula | C21H18N4O2 |
| Molecular Weight | 358.40 g/mol |
| Exact Mass | 358.14 |
| IUPAC Name | 1-(3-cyanophenyl)-3-[1-[(4-methylphenyl)methyl]-2-oxo-3-pyridinyl]urea |
| SMILES | Cc1ccc(Cn2cccc(NC(=O)Nc3cccc(C#N)c3)c2=O)cc1 |
| InChI | InChI=1S/C21H18N4O2/c1-15-7-9-16(10-8-15)14-25-11-3-6-19(20(25)26)24-21(27)23-18-5-2-4-17(12-18)13-22/h2-12H,14H2,1H3,(H2,23,24,27) |
| InChIKey | ROEVXASZFLGTBW-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 86.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.40 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |