C24H34N4O6 — CID 14501078
5,8-bis[3-(2-hydroxyethylamino)propylamino]anthracene-1,4,9,10-tetrol (PubChem CID 14501078) has the molecular formula C24H34N4O6 and a molecular weight of 474.56 g/mol. Its IUPAC name is 5,8-bis[3-(2-hydroxyethylamino)propylamino]anthracene-1,4,9,10-tetrol.
| Compound Name | 5,8-bis[3-(2-hydroxyethylamino)propylamino]anthracene-1,4,9,10-tetrol |
|---|---|
| PubChem CID | 14501078 |
| Molecular Formula | C24H34N4O6 |
| Molecular Weight | 474.56 g/mol |
| Exact Mass | 474.25 |
| IUPAC Name | 5,8-bis[3-(2-hydroxyethylamino)propylamino]anthracene-1,4,9,10-tetrol |
| SMILES | OCCNCCCNc1ccc(NCCCNCCO)c2c(O)c3c(O)ccc(O)c3c(O)c12 |
| InChI | InChI=1S/C24H34N4O6/c29-13-11-25-7-1-9-27-15-3-4-16(28-10-2-8-26-12-14-30)20-19(15)23(33)21-17(31)5-6-18(32)22(21)24(20)34/h3-6,25-34H,1-2,7-14H2 |
| InChIKey | RXIAQKXHATYZSF-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 169.50 Ų |
| H-Bond Donors | 10 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.56 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 10 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|