About ethane;5-[(3-methylphenyl)methylideneamino]benzene-1,3-diamine
ethane;5-[(3-methylphenyl)methylideneamino]benzene-1,3-diamine (PubChem CID 145010832) has the molecular formula C18H27N3
and a molecular weight of 285.44 g/mol. Its IUPAC name is ethane;5-[(3-methylphenyl)methylideneamino]benzene-1,3-diamine.
Molecular Properties
| Compound Name | ethane;5-[(3-methylphenyl)methylideneamino]benzene-1,3-diamine |
| PubChem CID | 145010832 |
| Molecular Formula | C18H27N3 |
| Molecular Weight | 285.44 g/mol |
| Exact Mass | 285.22 |
| IUPAC Name | ethane;5-[(3-methylphenyl)methylideneamino]benzene-1,3-diamine |
| SMILES | CC.CC.Cc1cccc(/C=N/c2cc(N)cc(N)c2)c1 |
| InChI | InChI=1S/C14H15N3.2C2H6/c1-10-3-2-4-11(5-10)9-17-14-7-12(15)6-13(16)8-14;2*1-2/h2-9H,15-16H2,1H3;2*1-2H3/b17-9+;; |
| InChIKey | YWIXGEZNJUOQNR-CECDQNOMSA-N |
| XLogP | 4.96 |
| TPSA | 64.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 285.44 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze ethane;5-[(3-methylphenyl)methylideneamino]benzene-1,3-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;5-[(3-methylphenyl)methylideneamino]benzene-1,3-diamine?
The IUPAC name of ethane;5-[(3-methylphenyl)methylideneamino]benzene-1,3-diamine (CID 145010832) is ethane;5-[(3-methylphenyl)methylideneamino]benzene-1,3-diamine.
What is the SMILES notation for ethane;5-[(3-methylphenyl)methylideneamino]benzene-1,3-diamine?
The canonical SMILES for ethane;5-[(3-methylphenyl)methylideneamino]benzene-1,3-diamine is CC.CC.Cc1cccc(/C=N/c2cc(N)cc(N)c2)c1.
What is the InChIKey of ethane;5-[(3-methylphenyl)methylideneamino]benzene-1,3-diamine?
The InChIKey is YWIXGEZNJUOQNR-CECDQNOMSA-N. The full InChI is InChI=1S/C14H15N3.2C2H6/c1-10-3-2-4-11(5-10)9-17-14-7-12(15)6-13(16)8-14;2*1-2/h2-9H,15-16H2,1H3;2*1-2H3/b17-9+;;.
What are the key properties of ethane;5-[(3-methylphenyl)methylideneamino]benzene-1,3-diamine?
ethane;5-[(3-methylphenyl)methylideneamino]benzene-1,3-diamine has a molecular weight of 285.44 g/mol, XLogP of 4.96, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;5-[(3-methylphenyl)methylideneamino]benzene-1,3-diamine is sourced from PubChem (CID 145010832), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).