About 1-(8-chloro-3-phenylindolizin-1-yl)ethanone;1,3-dimethylcyclohexan-1-ol
1-(8-chloro-3-phenylindolizin-1-yl)ethanone;1,3-dimethylcyclohexan-1-ol (PubChem CID 145010894) has the molecular formula C24H28ClNO2
and a molecular weight of 397.95 g/mol. Its IUPAC name is 1-(8-chloro-3-phenylindolizin-1-yl)ethanone;1,3-dimethylcyclohexan-1-ol.
Molecular Properties
| Compound Name | 1-(8-chloro-3-phenylindolizin-1-yl)ethanone;1,3-dimethylcyclohexan-1-ol |
| PubChem CID | 145010894 |
| Molecular Formula | C24H28ClNO2 |
| Molecular Weight | 397.95 g/mol |
| Exact Mass | 397.18 |
| IUPAC Name | 1-(8-chloro-3-phenylindolizin-1-yl)ethanone;1,3-dimethylcyclohexan-1-ol |
| SMILES | CC(=O)c1cc(-c2ccccc2)n2cccc(Cl)c12.CC1CCCC(C)(O)C1 |
| InChI | InChI=1S/C16H12ClNO.C8H16O/c1-11(19)13-10-15(12-6-3-2-4-7-12)18-9-5-8-14(17)16(13)18;1-7-4-3-5-8(2,9)6-7/h2-10H,1H3;7,9H,3-6H2,1-2H3 |
| InChIKey | PPZBDLULJBAVMA-UHFFFAOYSA-N |
| XLogP | 6.41 |
| TPSA | 41.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 397.95 |
| LogP ≤ 5 | 6.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-(8-chloro-3-phenylindolizin-1-yl)ethanone;1,3-dimethylcyclohexan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(8-chloro-3-phenylindolizin-1-yl)ethanone;1,3-dimethylcyclohexan-1-ol?
The IUPAC name of 1-(8-chloro-3-phenylindolizin-1-yl)ethanone;1,3-dimethylcyclohexan-1-ol (CID 145010894) is 1-(8-chloro-3-phenylindolizin-1-yl)ethanone;1,3-dimethylcyclohexan-1-ol.
What is the SMILES notation for 1-(8-chloro-3-phenylindolizin-1-yl)ethanone;1,3-dimethylcyclohexan-1-ol?
The canonical SMILES for 1-(8-chloro-3-phenylindolizin-1-yl)ethanone;1,3-dimethylcyclohexan-1-ol is CC(=O)c1cc(-c2ccccc2)n2cccc(Cl)c12.CC1CCCC(C)(O)C1.
What is the InChIKey of 1-(8-chloro-3-phenylindolizin-1-yl)ethanone;1,3-dimethylcyclohexan-1-ol?
The InChIKey is PPZBDLULJBAVMA-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H12ClNO.C8H16O/c1-11(19)13-10-15(12-6-3-2-4-7-12)18-9-5-8-14(17)16(13)18;1-7-4-3-5-8(2,9)6-7/h2-10H,1H3;7,9H,3-6H2,1-2H3.
What are the key properties of 1-(8-chloro-3-phenylindolizin-1-yl)ethanone;1,3-dimethylcyclohexan-1-ol?
1-(8-chloro-3-phenylindolizin-1-yl)ethanone;1,3-dimethylcyclohexan-1-ol has a molecular weight of 397.95 g/mol, XLogP of 6.41, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(8-chloro-3-phenylindolizin-1-yl)ethanone;1,3-dimethylcyclohexan-1-ol is sourced from PubChem (CID 145010894), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).