C19H13N7O — CID 145011141
4-[4-amino-7-(3-cyanophenyl)imidazo[5,1-f][1,2,4]triazin-5-yl]benzamide (PubChem CID 145011141) has the molecular formula C19H13N7O and a molecular weight of 355.36 g/mol. Its IUPAC name is 4-[4-amino-7-(3-cyanophenyl)imidazo[5,1-f][1,2,4]triazin-5-yl]benzamide.
| Compound Name | 4-[4-amino-7-(3-cyanophenyl)imidazo[5,1-f][1,2,4]triazin-5-yl]benzamide |
|---|---|
| PubChem CID | 145011141 |
| Molecular Formula | C19H13N7O |
| Molecular Weight | 355.36 g/mol |
| Exact Mass | 355.12 |
| IUPAC Name | 4-[4-amino-7-(3-cyanophenyl)imidazo[5,1-f][1,2,4]triazin-5-yl]benzamide |
| SMILES | N#Cc1cccc(-c2nc(-c3ccc(C(N)=O)cc3)c3c(N)ncnn23)c1 |
| InChI | InChI=1S/C19H13N7O/c20-9-11-2-1-3-14(8-11)19-25-15(16-17(21)23-10-24-26(16)19)12-4-6-13(7-5-12)18(22)27/h1-8,10H,(H2,22,27)(H2,21,23,24) |
| InChIKey | QLOGTAQJHYLZCU-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 135.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.36 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |