C10H14F3N3 — CID 145011887
(2Z,4Z)-6,6,6-trifluoro-N,2-dimethyl-5-(methylideneamino)-1-methyliminohexa-2,4-dien-3-amine (PubChem CID 145011887) has the molecular formula C10H14F3N3 and a molecular weight of 233.24 g/mol. Its IUPAC name is (2Z,4Z)-6,6,6-trifluoro-N,2-dimethyl-5-(methylideneamino)-1-methyliminohexa-2,4-dien-3-amine.
| Compound Name | (2Z,4Z)-6,6,6-trifluoro-N,2-dimethyl-5-(methylideneamino)-1-methyliminohexa-2,4-dien-3-amine |
|---|---|
| PubChem CID | 145011887 |
| Molecular Formula | C10H14F3N3 |
| Molecular Weight | 233.24 g/mol |
| Exact Mass | 233.11 |
| IUPAC Name | (2Z,4Z)-6,6,6-trifluoro-N,2-dimethyl-5-(methylideneamino)-1-methyliminohexa-2,4-dien-3-amine |
| SMILES | C=N/C(=C\C(NC)=C(C)\C=N\C)C(F)(F)F |
| InChI | InChI=1S/C10H14F3N3/c1-7(6-14-2)8(15-3)5-9(16-4)10(11,12)13/h5-6,15H,4H2,1-3H3/b8-7-,9-5-,14-6+ |
| InChIKey | ZBRYNJYAIMLNKZ-NNUWOQIBSA-N |
| XLogP | 2.33 |
| TPSA | 36.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.24 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|