C15H29F2N — CID 145011954
(2E,4E)-6,6-difluoro-N,2,5-trimethyl-N-propan-2-ylhepta-2,4-dien-1-amine;ethane (PubChem CID 145011954) has the molecular formula C15H29F2N and a molecular weight of 261.40 g/mol. Its IUPAC name is (2E,4E)-6,6-difluoro-N,2,5-trimethyl-N-propan-2-ylhepta-2,4-dien-1-amine;ethane.
| Compound Name | (2E,4E)-6,6-difluoro-N,2,5-trimethyl-N-propan-2-ylhepta-2,4-dien-1-amine;ethane |
|---|---|
| PubChem CID | 145011954 |
| Molecular Formula | C15H29F2N |
| Molecular Weight | 261.40 g/mol |
| Exact Mass | 261.23 |
| IUPAC Name | (2E,4E)-6,6-difluoro-N,2,5-trimethyl-N-propan-2-ylhepta-2,4-dien-1-amine;ethane |
| SMILES | C/C(=C\C=C(/C)C(C)(F)F)CN(C)C(C)C.CC |
| InChI | InChI=1S/C13H23F2N.C2H6/c1-10(2)16(6)9-11(3)7-8-12(4)13(5,14)15;1-2/h7-8,10H,9H2,1-6H3;1-2H3/b11-7+,12-8+; |
| InChIKey | UTOZTDMKXORGSV-GCHDFIKQSA-N |
| XLogP | 4.90 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.40 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|