About ethane;(E)-N,N,2-trimethylbut-1-en-1-amine
ethane;(E)-N,N,2-trimethylbut-1-en-1-amine (PubChem CID 145011987) has the molecular formula C9H21N
and a molecular weight of 143.27 g/mol. Its IUPAC name is ethane;(E)-N,N,2-trimethylbut-1-en-1-amine.
Molecular Properties
| Compound Name | ethane;(E)-N,N,2-trimethylbut-1-en-1-amine |
| PubChem CID | 145011987 |
| Molecular Formula | C9H21N |
| Molecular Weight | 143.27 g/mol |
| Exact Mass | 143.17 |
| IUPAC Name | ethane;(E)-N,N,2-trimethylbut-1-en-1-amine |
| SMILES | CC.CC/C(C)=C/N(C)C |
| InChI | InChI=1S/C7H15N.C2H6/c1-5-7(2)6-8(3)4;1-2/h6H,5H2,1-4H3;1-2H3/b7-6+; |
| InChIKey | DMKJZOMYLRQUKN-UHDJGPCESA-N |
| XLogP | 2.89 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 143.27 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze ethane;(E)-N,N,2-trimethylbut-1-en-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;(E)-N,N,2-trimethylbut-1-en-1-amine?
The IUPAC name of ethane;(E)-N,N,2-trimethylbut-1-en-1-amine (CID 145011987) is ethane;(E)-N,N,2-trimethylbut-1-en-1-amine.
What is the SMILES notation for ethane;(E)-N,N,2-trimethylbut-1-en-1-amine?
The canonical SMILES for ethane;(E)-N,N,2-trimethylbut-1-en-1-amine is CC.CC/C(C)=C/N(C)C.
What is the InChIKey of ethane;(E)-N,N,2-trimethylbut-1-en-1-amine?
The InChIKey is DMKJZOMYLRQUKN-UHDJGPCESA-N. The full InChI is InChI=1S/C7H15N.C2H6/c1-5-7(2)6-8(3)4;1-2/h6H,5H2,1-4H3;1-2H3/b7-6+;.
What are the key properties of ethane;(E)-N,N,2-trimethylbut-1-en-1-amine?
ethane;(E)-N,N,2-trimethylbut-1-en-1-amine has a molecular weight of 143.27 g/mol, XLogP of 2.89, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;(E)-N,N,2-trimethylbut-1-en-1-amine is sourced from PubChem (CID 145011987), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).