About (2R)-2-[(2Z,4E)-4-(trifluoromethyl)hexa-2,4-dienyl]pyrrolidine
(2R)-2-[(2Z,4E)-4-(trifluoromethyl)hexa-2,4-dienyl]pyrrolidine (PubChem CID 145012025) has the molecular formula C11H16F3N
and a molecular weight of 219.25 g/mol. Its IUPAC name is (2R)-2-[(2Z,4E)-4-(trifluoromethyl)hexa-2,4-dienyl]pyrrolidine.
Molecular Properties
| Compound Name | (2R)-2-[(2Z,4E)-4-(trifluoromethyl)hexa-2,4-dienyl]pyrrolidine |
| PubChem CID | 145012025 |
| Molecular Formula | C11H16F3N |
| Molecular Weight | 219.25 g/mol |
| Exact Mass | 219.12 |
| IUPAC Name | (2R)-2-[(2Z,4E)-4-(trifluoromethyl)hexa-2,4-dienyl]pyrrolidine |
| SMILES | C/C=C(\C=C/C[C@H]1CCCN1)C(F)(F)F |
| InChI | InChI=1S/C11H16F3N/c1-2-9(11(12,13)14)5-3-6-10-7-4-8-15-10/h2-3,5,10,15H,4,6-8H2,1H3/b5-3-,9-2+/t10-/m0/s1 |
| InChIKey | OLUVOGXNMOWNLT-GEVXLEJPSA-N |
| XLogP | 3.19 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 219.25 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (2R)-2-[(2Z,4E)-4-(trifluoromethyl)hexa-2,4-dienyl]pyrrolidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R)-2-[(2Z,4E)-4-(trifluoromethyl)hexa-2,4-dienyl]pyrrolidine?
The IUPAC name of (2R)-2-[(2Z,4E)-4-(trifluoromethyl)hexa-2,4-dienyl]pyrrolidine (CID 145012025) is (2R)-2-[(2Z,4E)-4-(trifluoromethyl)hexa-2,4-dienyl]pyrrolidine.
What is the SMILES notation for (2R)-2-[(2Z,4E)-4-(trifluoromethyl)hexa-2,4-dienyl]pyrrolidine?
The canonical SMILES for (2R)-2-[(2Z,4E)-4-(trifluoromethyl)hexa-2,4-dienyl]pyrrolidine is C/C=C(\C=C/C[C@H]1CCCN1)C(F)(F)F.
What is the InChIKey of (2R)-2-[(2Z,4E)-4-(trifluoromethyl)hexa-2,4-dienyl]pyrrolidine?
The InChIKey is OLUVOGXNMOWNLT-GEVXLEJPSA-N. The full InChI is InChI=1S/C11H16F3N/c1-2-9(11(12,13)14)5-3-6-10-7-4-8-15-10/h2-3,5,10,15H,4,6-8H2,1H3/b5-3-,9-2+/t10-/m0/s1.
What are the key properties of (2R)-2-[(2Z,4E)-4-(trifluoromethyl)hexa-2,4-dienyl]pyrrolidine?
(2R)-2-[(2Z,4E)-4-(trifluoromethyl)hexa-2,4-dienyl]pyrrolidine has a molecular weight of 219.25 g/mol, XLogP of 3.19, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-2-[(2Z,4E)-4-(trifluoromethyl)hexa-2,4-dienyl]pyrrolidine is sourced from PubChem (CID 145012025), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).