About (2R)-2-[(2E,4E)-5-ethyl-6-fluoro-6-methylhepta-2,4-dien-2-yl]pyrrolidine
(2R)-2-[(2E,4E)-5-ethyl-6-fluoro-6-methylhepta-2,4-dien-2-yl]pyrrolidine (PubChem CID 145012084) has the molecular formula C14H24FN
and a molecular weight of 225.35 g/mol. Its IUPAC name is (2R)-2-[(2E,4E)-5-ethyl-6-fluoro-6-methylhepta-2,4-dien-2-yl]pyrrolidine.
Molecular Properties
| Compound Name | (2R)-2-[(2E,4E)-5-ethyl-6-fluoro-6-methylhepta-2,4-dien-2-yl]pyrrolidine |
| PubChem CID | 145012084 |
| Molecular Formula | C14H24FN |
| Molecular Weight | 225.35 g/mol |
| Exact Mass | 225.19 |
| IUPAC Name | (2R)-2-[(2E,4E)-5-ethyl-6-fluoro-6-methylhepta-2,4-dien-2-yl]pyrrolidine |
| SMILES | CC/C(=C\C=C(/C)[C@H]1CCCN1)C(C)(C)F |
| InChI | InChI=1S/C14H24FN/c1-5-12(14(3,4)15)9-8-11(2)13-7-6-10-16-13/h8-9,13,16H,5-7,10H2,1-4H3/b11-8+,12-9+/t13-/m1/s1 |
| InChIKey | QKHDKURKYIKBOZ-ZWLHLFAHSA-N |
| XLogP | 3.77 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 225.35 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (2R)-2-[(2E,4E)-5-ethyl-6-fluoro-6-methylhepta-2,4-dien-2-yl]pyrrolidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R)-2-[(2E,4E)-5-ethyl-6-fluoro-6-methylhepta-2,4-dien-2-yl]pyrrolidine?
The IUPAC name of (2R)-2-[(2E,4E)-5-ethyl-6-fluoro-6-methylhepta-2,4-dien-2-yl]pyrrolidine (CID 145012084) is (2R)-2-[(2E,4E)-5-ethyl-6-fluoro-6-methylhepta-2,4-dien-2-yl]pyrrolidine.
What is the SMILES notation for (2R)-2-[(2E,4E)-5-ethyl-6-fluoro-6-methylhepta-2,4-dien-2-yl]pyrrolidine?
The canonical SMILES for (2R)-2-[(2E,4E)-5-ethyl-6-fluoro-6-methylhepta-2,4-dien-2-yl]pyrrolidine is CC/C(=C\C=C(/C)[C@H]1CCCN1)C(C)(C)F.
What is the InChIKey of (2R)-2-[(2E,4E)-5-ethyl-6-fluoro-6-methylhepta-2,4-dien-2-yl]pyrrolidine?
The InChIKey is QKHDKURKYIKBOZ-ZWLHLFAHSA-N. The full InChI is InChI=1S/C14H24FN/c1-5-12(14(3,4)15)9-8-11(2)13-7-6-10-16-13/h8-9,13,16H,5-7,10H2,1-4H3/b11-8+,12-9+/t13-/m1/s1.
What are the key properties of (2R)-2-[(2E,4E)-5-ethyl-6-fluoro-6-methylhepta-2,4-dien-2-yl]pyrrolidine?
(2R)-2-[(2E,4E)-5-ethyl-6-fluoro-6-methylhepta-2,4-dien-2-yl]pyrrolidine has a molecular weight of 225.35 g/mol, XLogP of 3.77, 4 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-2-[(2E,4E)-5-ethyl-6-fluoro-6-methylhepta-2,4-dien-2-yl]pyrrolidine is sourced from PubChem (CID 145012084), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).