C10H12N4 — CID 145012496
2-amino-5-methylbenzonitrile;ethane-1,2-diimine (PubChem CID 145012496) has the molecular formula C10H12N4 and a molecular weight of 188.23 g/mol. Its IUPAC name is 2-amino-5-methylbenzonitrile;ethane-1,2-diimine.
| Compound Name | 2-amino-5-methylbenzonitrile;ethane-1,2-diimine |
|---|---|
| PubChem CID | 145012496 |
| Molecular Formula | C10H12N4 |
| Molecular Weight | 188.23 g/mol |
| Exact Mass | 188.11 |
| IUPAC Name | 2-amino-5-methylbenzonitrile;ethane-1,2-diimine |
| SMILES | Cc1ccc(N)c(C#N)c1.[H]/N=C/C=N/[H] |
| InChI | InChI=1S/C8H8N2.C2H4N2/c1-6-2-3-8(10)7(4-6)5-9;3-1-2-4/h2-4H,10H2,1H3;1-4H/b;3-1+,4-2+ |
| InChIKey | ULERZWPQJSHTHM-BZGZIVBQSA-N |
| XLogP | 1.73 |
| TPSA | 97.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.23 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|