C15H25N3O — CID 145012520
(2E)-4-methyl-2-[1-(methylamino)ethenyl]-1-(7-methyl-1,4-diazepan-1-yl)penta-2,4-dien-1-one (PubChem CID 145012520) has the molecular formula C15H25N3O and a molecular weight of 263.38 g/mol. Its IUPAC name is (2E)-4-methyl-2-[1-(methylamino)ethenyl]-1-(7-methyl-1,4-diazepan-1-yl)penta-2,4-dien-1-one.
| Compound Name | (2E)-4-methyl-2-[1-(methylamino)ethenyl]-1-(7-methyl-1,4-diazepan-1-yl)penta-2,4-dien-1-one |
|---|---|
| PubChem CID | 145012520 |
| Molecular Formula | C15H25N3O |
| Molecular Weight | 263.38 g/mol |
| Exact Mass | 263.20 |
| IUPAC Name | (2E)-4-methyl-2-[1-(methylamino)ethenyl]-1-(7-methyl-1,4-diazepan-1-yl)penta-2,4-dien-1-one |
| SMILES | C=C(C)/C=C(\C(=C)NC)C(=O)N1CCNCCC1C |
| InChI | InChI=1S/C15H25N3O/c1-11(2)10-14(13(4)16-5)15(19)18-9-8-17-7-6-12(18)3/h10,12,16-17H,1,4,6-9H2,2-3,5H3/b14-10+ |
| InChIKey | CSUOCEQBDWDLSU-GXDHUFHOSA-N |
| XLogP | 1.43 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.38 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|