C16H23N5O2 — CID 145012522
1-(2-amino-5-methylbenzoyl)-7-methyl-1,4-diazepan-5-one;ethane-1,2-diimine (PubChem CID 145012522) has the molecular formula C16H23N5O2 and a molecular weight of 317.39 g/mol. Its IUPAC name is 1-(2-amino-5-methylbenzoyl)-7-methyl-1,4-diazepan-5-one;ethane-1,2-diimine.
| Compound Name | 1-(2-amino-5-methylbenzoyl)-7-methyl-1,4-diazepan-5-one;ethane-1,2-diimine |
|---|---|
| PubChem CID | 145012522 |
| Molecular Formula | C16H23N5O2 |
| Molecular Weight | 317.39 g/mol |
| Exact Mass | 317.19 |
| IUPAC Name | 1-(2-amino-5-methylbenzoyl)-7-methyl-1,4-diazepan-5-one;ethane-1,2-diimine |
| SMILES | Cc1ccc(N)c(C(=O)N2CCNC(=O)CC2C)c1.[H]/N=C/C=N/[H] |
| InChI | InChI=1S/C14H19N3O2.C2H4N2/c1-9-3-4-12(15)11(7-9)14(19)17-6-5-16-13(18)8-10(17)2;3-1-2-4/h3-4,7,10H,5-6,8,15H2,1-2H3,(H,16,18);1-4H/b;3-1+,4-2+ |
| InChIKey | ANLUDJPFVVASIF-BZGZIVBQSA-N |
| XLogP | 1.21 |
| TPSA | 123.13 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.39 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|